About N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide
N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide (PubChem CID 166442964) has the molecular formula C16H8F6N2OS3
and a molecular weight of 454.44 g/mol. Its IUPAC name is N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide |
| PubChem CID | 166442964 |
| Molecular Formula | C16H8F6N2OS3 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1c(SC(F)(F)F)csc1SC(F)(F)F |
| InChI | InChI=1S/C16H8F6N2OS3/c17-15(18,19)27-10-7-26-14(28-16(20,21)22)11(10)13(25)24-9-5-1-3-8-4-2-6-23-12(8)9/h1-7H,(H,24,25) |
| InChIKey | ZTZQNNBFECGBCU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide?
The IUPAC name of N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide (CID 166442964) is N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide.
What is the SMILES notation for N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide?
The canonical SMILES for N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide is O=C(Nc1cccc2cccnc12)c1c(SC(F)(F)F)csc1SC(F)(F)F.
What is the InChIKey of N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide?
The InChIKey is ZTZQNNBFECGBCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F6N2OS3/c17-15(18,19)27-10-7-26-14(28-16(20,21)22)11(10)13(25)24-9-5-1-3-8-4-2-6-23-12(8)9/h1-7H,(H,24,25).
What are the key properties of N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide?
N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide has a molecular weight of 454.44 g/mol, XLogP of 6.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-quinolin-8-yl-2,4-bis(trifluoromethylsulfanyl)thiophene-3-carboxamide is sourced from PubChem (CID 166442964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).