C31H32N2O7 — CID 166443254
[[2-(4-methylphenyl)-2-(5,6,7-trimethoxy-2-oxo-4-phenylquinolin-1-yl)acetyl]amino]methyl propanoate (PubChem CID 166443254) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is [[2-(4-methylphenyl)-2-(5,6,7-trimethoxy-2-oxo-4-phenylquinolin-1-yl)acetyl]amino]methyl propanoate.
| Compound Name | [[2-(4-methylphenyl)-2-(5,6,7-trimethoxy-2-oxo-4-phenylquinolin-1-yl)acetyl]amino]methyl propanoate |
|---|---|
| PubChem CID | 166443254 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | [[2-(4-methylphenyl)-2-(5,6,7-trimethoxy-2-oxo-4-phenylquinolin-1-yl)acetyl]amino]methyl propanoate |
| SMILES | CCC(=O)OCNC(=O)C(c1ccc(C)cc1)n1c(=O)cc(-c2ccccc2)c2c(OC)c(OC)c(OC)cc21 |
| InChI | InChI=1S/C31H32N2O7/c1-6-26(35)40-18-32-31(36)28(21-14-12-19(2)13-15-21)33-23-17-24(37-3)29(38-4)30(39-5)27(23)22(16-25(33)34)20-10-8-7-9-11-20/h7-17,28H,6,18H2,1-5H3,(H,32,36) |
| InChIKey | MEWMFTFEGDFKTE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|