C13H18N4OS2 — CID 16644360
2,4-dimethyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 16644360) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 16644360 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2,4-dimethyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2sc(C)nc2C)s1 |
| InChI | InChI=1S/C13H18N4OS2/c1-4-5-6-7-10-16-17-13(20-10)15-12(18)11-8(2)14-9(3)19-11/h4-7H2,1-3H3,(H,15,17,18) |
| InChIKey | SLTHQXHVJVLKKB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|