C21H14Br2N2 — CID 166443638
3,4-bis(4-bromophenyl)quinolin-2-amine (PubChem CID 166443638) has the molecular formula C21H14Br2N2 and a molecular weight of 454.17 g/mol. Its IUPAC name is 3,4-bis(4-bromophenyl)quinolin-2-amine.
| Compound Name | 3,4-bis(4-bromophenyl)quinolin-2-amine |
|---|---|
| PubChem CID | 166443638 |
| Molecular Formula | C21H14Br2N2 |
| Molecular Weight | 454.17 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 3,4-bis(4-bromophenyl)quinolin-2-amine |
| SMILES | Nc1nc2ccccc2c(-c2ccc(Br)cc2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H14Br2N2/c22-15-9-5-13(6-10-15)19-17-3-1-2-4-18(17)25-21(24)20(19)14-7-11-16(23)12-8-14/h1-12H,(H2,24,25) |
| InChIKey | POXIQLCCAGZVST-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |