About 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide
2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide (PubChem CID 166443914) has the molecular formula C12H14F3NO2
and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide |
| PubChem CID | 166443914 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide |
| SMILES | CO[C@@H](CC(F)(F)F)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C12H14F3NO2/c1-8-5-3-4-6-9(8)11(17)16-10(18-2)7-12(13,14)15/h3-6,10H,7H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | LWAFXGXCSCCKMC-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide?
The IUPAC name of 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide (CID 166443914) is 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide.
What is the SMILES notation for 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide?
The canonical SMILES for 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide is CO[C@@H](CC(F)(F)F)NC(=O)c1ccccc1C.
What is the InChIKey of 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide?
The InChIKey is LWAFXGXCSCCKMC-JTQLQIEISA-N. The full InChI is InChI=1S/C12H14F3NO2/c1-8-5-3-4-6-9(8)11(17)16-10(18-2)7-12(13,14)15/h3-6,10H,7H2,1-2H3,(H,16,17)/t10-/m0/s1.
What are the key properties of 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide?
2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide has a molecular weight of 261.24 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(1S)-3,3,3-trifluoro-1-methoxypropyl]benzamide is sourced from PubChem (CID 166443914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).