C23H22O4 — CID 166444102
benzyl 2-[(3aR)-3-oxo-3a-phenyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate (PubChem CID 166444102) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is benzyl 2-[(3aR)-3-oxo-3a-phenyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate.
| Compound Name | benzyl 2-[(3aR)-3-oxo-3a-phenyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate |
|---|---|
| PubChem CID | 166444102 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | benzyl 2-[(3aR)-3-oxo-3a-phenyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate |
| SMILES | O=C(CC1OC(=O)[C@@]2(c3ccccc3)CCCC=C12)OCc1ccccc1 |
| InChI | InChI=1S/C23H22O4/c24-21(26-16-17-9-3-1-4-10-17)15-20-19-13-7-8-14-23(19,22(25)27-20)18-11-5-2-6-12-18/h1-6,9-13,20H,7-8,14-16H2/t20?,23-/m1/s1 |
| InChIKey | FACAGZMWRFFZBF-GWQXNCQPSA-N |
| XLogP | 4.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|