C30H33Cl2NO2 — CID 166444143
ethyl 3-benzyl-4-[[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]butanoate (PubChem CID 166444143) has the molecular formula C30H33Cl2NO2 and a molecular weight of 510.51 g/mol. Its IUPAC name is ethyl 3-benzyl-4-[[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]butanoate.
| Compound Name | ethyl 3-benzyl-4-[[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]butanoate |
|---|---|
| PubChem CID | 166444143 |
| Molecular Formula | C30H33Cl2NO2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | ethyl 3-benzyl-4-[[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]butanoate |
| SMILES | CCOC(=O)CC(Cc1ccccc1)CN(C)[C@@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C30H33Cl2NO2/c1-3-35-30(34)18-22(17-21-9-5-4-6-10-21)20-33(2)29-16-14-24(25-11-7-8-12-26(25)29)23-13-15-27(31)28(32)19-23/h4-13,15,19,22,24,29H,3,14,16-18,20H2,1-2H3/t22?,24-,29+/m0/s1 |
| InChIKey | HMDILMSPKYGICF-SOABOUKKSA-N |
| XLogP | 7.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |