About benzene;fluoronickel;tricyclohexylphosphanium
benzene;fluoronickel;tricyclohexylphosphanium (PubChem CID 166444151) has the molecular formula C24H39FNiP
and a molecular weight of 436.24 g/mol. Its IUPAC name is benzene;fluoronickel;tricyclohexylphosphanium.
Molecular Properties
| Compound Name | benzene;fluoronickel;tricyclohexylphosphanium |
| PubChem CID | 166444151 |
| Molecular Formula | C24H39FNiP |
| Molecular Weight | 436.24 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | benzene;fluoronickel;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.F[Ni].[c-]1ccccc1 |
| InChI | InChI=1S/C18H33P.C6H5.FH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1;;/h16-18H,1-15H2;1-5H;1H;/q;-1;;+1 |
| InChIKey | QHRSLOQVCQKYDZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.24 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;fluoronickel;tricyclohexylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;fluoronickel;tricyclohexylphosphanium?
The IUPAC name of benzene;fluoronickel;tricyclohexylphosphanium (CID 166444151) is benzene;fluoronickel;tricyclohexylphosphanium.
What is the SMILES notation for benzene;fluoronickel;tricyclohexylphosphanium?
The canonical SMILES for benzene;fluoronickel;tricyclohexylphosphanium is C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.F[Ni].[c-]1ccccc1.
What is the InChIKey of benzene;fluoronickel;tricyclohexylphosphanium?
The InChIKey is QHRSLOQVCQKYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.C6H5.FH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1;;/h16-18H,1-15H2;1-5H;1H;/q;-1;;+1.
What are the key properties of benzene;fluoronickel;tricyclohexylphosphanium?
benzene;fluoronickel;tricyclohexylphosphanium has a molecular weight of 436.24 g/mol, XLogP of 8.10, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;fluoronickel;tricyclohexylphosphanium is sourced from PubChem (CID 166444151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).