C19H31N5O6 — CID 166444203
3-[[(2S,3R)-3-[[(4R)-4-[(1-ethyltriazol-4-yl)methoxy]pyrrolidine-2-carbonyl]amino]oxan-2-yl]methoxy]propanoic acid (PubChem CID 166444203) has the molecular formula C19H31N5O6 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[[(2S,3R)-3-[[(4R)-4-[(1-ethyltriazol-4-yl)methoxy]pyrrolidine-2-carbonyl]amino]oxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(2S,3R)-3-[[(4R)-4-[(1-ethyltriazol-4-yl)methoxy]pyrrolidine-2-carbonyl]amino]oxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 166444203 |
| Molecular Formula | C19H31N5O6 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-[[(2S,3R)-3-[[(4R)-4-[(1-ethyltriazol-4-yl)methoxy]pyrrolidine-2-carbonyl]amino]oxan-2-yl]methoxy]propanoic acid |
| SMILES | CCn1cc(CO[C@H]2CNC(C(=O)N[C@@H]3CCCO[C@@H]3COCCC(=O)O)C2)nn1 |
| InChI | InChI=1S/C19H31N5O6/c1-2-24-10-13(22-23-24)11-30-14-8-16(20-9-14)19(27)21-15-4-3-6-29-17(15)12-28-7-5-18(25)26/h10,14-17,20H,2-9,11-12H2,1H3,(H,21,27)(H,25,26)/t14-,15-,16?,17-/m1/s1 |
| InChIKey | FPORXFQSNFUXTJ-FRBBGCKASA-N |
| XLogP | -0.30 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|