C27H34F3NO6S — CID 166444376
dicyclohexyl (2Z,4E)-3-[[4-methyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate (PubChem CID 166444376) has the molecular formula C27H34F3NO6S and a molecular weight of 557.63 g/mol. Its IUPAC name is dicyclohexyl (2Z,4E)-3-[[4-methyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate.
| Compound Name | dicyclohexyl (2Z,4E)-3-[[4-methyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 166444376 |
| Molecular Formula | C27H34F3NO6S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | dicyclohexyl (2Z,4E)-3-[[4-methyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
| SMILES | Cc1ccc(CC(=C/C(=O)OC2CCCCC2)/C=C/C(=O)OC2CCCCC2)c(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H34F3NO6S/c1-19-12-14-21(24(16-19)31-38(34,35)27(28,29)30)17-20(18-26(33)37-23-10-6-3-7-11-23)13-15-25(32)36-22-8-4-2-5-9-22/h12-16,18,22-23,31H,2-11,17H2,1H3/b15-13+,20-18+ |
| InChIKey | BAZZTHLTGGRVHP-MQPHZJRASA-N |
| XLogP | 6.03 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|