C28H24F3NO6S — CID 166444377
dibenzyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate (PubChem CID 166444377) has the molecular formula C28H24F3NO6S and a molecular weight of 559.56 g/mol. Its IUPAC name is dibenzyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate.
| Compound Name | dibenzyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 166444377 |
| Molecular Formula | C28H24F3NO6S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | dibenzyl (2Z,4E)-3-[[2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
| SMILES | O=C(/C=C(\C=C\C(=O)OCc1ccccc1)Cc1ccccc1NS(=O)(=O)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C28H24F3NO6S/c29-28(30,31)39(35,36)32-25-14-8-7-13-24(25)17-23(18-27(34)38-20-22-11-5-2-6-12-22)15-16-26(33)37-19-21-9-3-1-4-10-21/h1-16,18,32H,17,19-20H2/b16-15+,23-18+ |
| InChIKey | ZCWOGKOQBMVSSI-ZQQFMRGOSA-N |
| XLogP | 5.46 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|