C18H20F3NO6S — CID 166444379
dimethyl (2Z,4E)-3-[[3-ethyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate (PubChem CID 166444379) has the molecular formula C18H20F3NO6S and a molecular weight of 435.42 g/mol. Its IUPAC name is dimethyl (2Z,4E)-3-[[3-ethyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate.
| Compound Name | dimethyl (2Z,4E)-3-[[3-ethyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 166444379 |
| Molecular Formula | C18H20F3NO6S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | dimethyl (2Z,4E)-3-[[3-ethyl-2-(trifluoromethylsulfonylamino)phenyl]methyl]hexa-2,4-dienedioate |
| SMILES | CCc1cccc(CC(=C/C(=O)OC)/C=C/C(=O)OC)c1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO6S/c1-4-13-6-5-7-14(17(13)22-29(25,26)18(19,20)21)10-12(11-16(24)28-3)8-9-15(23)27-2/h5-9,11,22H,4,10H2,1-3H3/b9-8+,12-11+ |
| InChIKey | JXPSKILAYVDVSZ-MVKOLZDDSA-N |
| XLogP | 2.88 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|