C24H42O4 — CID 166444413
ethyl (1S,4aS,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 166444413) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is ethyl (1S,4aS,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,4aS,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 166444413 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | ethyl (1S,4aS,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | CCCCCC[C@@H](C)C1C=C[C@@H]2C(OCOC)CCC[C@H]2[C@]1(C)C(=O)OCC |
| InChI | InChI=1S/C24H42O4/c1-6-8-9-10-12-18(3)20-16-15-19-21(24(20,4)23(25)27-7-2)13-11-14-22(19)28-17-26-5/h15-16,18-22H,6-14,17H2,1-5H3/t18-,19+,20?,21-,22?,24-/m1/s1 |
| InChIKey | OCOIBMFEDWFZIG-BJNMMCSLSA-N |
| XLogP | 5.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|