C24H40O4 — CID 166444414
(Z)-1-[(1S,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-hydroxyprop-2-en-1-one (PubChem CID 166444414) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (Z)-1-[(1S,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-hydroxyprop-2-en-1-one.
| Compound Name | (Z)-1-[(1S,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 166444414 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (Z)-1-[(1S,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-hydroxyprop-2-en-1-one |
| SMILES | CCCCCC[C@@H](C)C1C=C[C@H]2[C@@H](CCC[C@H]2OCOC)[C@]1(C)C(=O)/C=C\O |
| InChI | InChI=1S/C24H40O4/c1-5-6-7-8-10-18(2)20-14-13-19-21(24(20,3)23(26)15-16-25)11-9-12-22(19)28-17-27-4/h13-16,18-22,25H,5-12,17H2,1-4H3/b16-15-/t18-,19+,20?,21-,22-,24-/m1/s1 |
| InChIKey | AVHUDSKIDCGLRX-XMQIDAFQSA-N |
| XLogP | 5.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|