C19H32O4Si — CID 166444493
methyl (3R,3aR,8aR)-3-methyl-8-oxo-3-triethylsilyloxy-1,2,3a,4,7,8a-hexahydroazulene-5-carboxylate (PubChem CID 166444493) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is methyl (3R,3aR,8aR)-3-methyl-8-oxo-3-triethylsilyloxy-1,2,3a,4,7,8a-hexahydroazulene-5-carboxylate.
| Compound Name | methyl (3R,3aR,8aR)-3-methyl-8-oxo-3-triethylsilyloxy-1,2,3a,4,7,8a-hexahydroazulene-5-carboxylate |
|---|---|
| PubChem CID | 166444493 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl (3R,3aR,8aR)-3-methyl-8-oxo-3-triethylsilyloxy-1,2,3a,4,7,8a-hexahydroazulene-5-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@H]2C(=O)CC=C(C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C19H32O4Si/c1-6-24(7-2,8-3)23-19(4)12-11-15-16(19)13-14(18(21)22-5)9-10-17(15)20/h9,15-16H,6-8,10-13H2,1-5H3/t15-,16-,19-/m1/s1 |
| InChIKey | YTEHAUODKGZCED-GPMSIDNRSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|