About 6-(difluoromethyl)-3,7-dimethyloctan-1-ol
6-(difluoromethyl)-3,7-dimethyloctan-1-ol (PubChem CID 166444510) has the molecular formula C11H22F2O
and a molecular weight of 208.29 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,7-dimethyloctan-1-ol.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-3,7-dimethyloctan-1-ol |
| PubChem CID | 166444510 |
| Molecular Formula | C11H22F2O |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 6-(difluoromethyl)-3,7-dimethyloctan-1-ol |
| SMILES | CC(CCO)CCC(C(C)C)C(F)F |
| InChI | InChI=1S/C11H22F2O/c1-8(2)10(11(12)13)5-4-9(3)6-7-14/h8-11,14H,4-7H2,1-3H3 |
| InChIKey | VVMIWJUVIHSMKY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(difluoromethyl)-3,7-dimethyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-3,7-dimethyloctan-1-ol?
The IUPAC name of 6-(difluoromethyl)-3,7-dimethyloctan-1-ol (CID 166444510) is 6-(difluoromethyl)-3,7-dimethyloctan-1-ol.
What is the SMILES notation for 6-(difluoromethyl)-3,7-dimethyloctan-1-ol?
The canonical SMILES for 6-(difluoromethyl)-3,7-dimethyloctan-1-ol is CC(CCO)CCC(C(C)C)C(F)F.
What is the InChIKey of 6-(difluoromethyl)-3,7-dimethyloctan-1-ol?
The InChIKey is VVMIWJUVIHSMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2O/c1-8(2)10(11(12)13)5-4-9(3)6-7-14/h8-11,14H,4-7H2,1-3H3.
What are the key properties of 6-(difluoromethyl)-3,7-dimethyloctan-1-ol?
6-(difluoromethyl)-3,7-dimethyloctan-1-ol has a molecular weight of 208.29 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-3,7-dimethyloctan-1-ol is sourced from PubChem (CID 166444510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).