About 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide
2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide (PubChem CID 166444522) has the molecular formula C11H20FNO2
and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide |
| PubChem CID | 166444522 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide |
| SMILES | C=C[C@H](NC(=O)CF)[C@H](O)CCCCC |
| InChI | InChI=1S/C11H20FNO2/c1-3-5-6-7-10(14)9(4-2)13-11(15)8-12/h4,9-10,14H,2-3,5-8H2,1H3,(H,13,15)/t9-,10+/m0/s1 |
| InChIKey | BIMCEUGBCNCFDV-VHSXEESVSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide?
The IUPAC name of 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide (CID 166444522) is 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide.
What is the SMILES notation for 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide?
The canonical SMILES for 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide is C=C[C@H](NC(=O)CF)[C@H](O)CCCCC.
What is the InChIKey of 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide?
The InChIKey is BIMCEUGBCNCFDV-VHSXEESVSA-N. The full InChI is InChI=1S/C11H20FNO2/c1-3-5-6-7-10(14)9(4-2)13-11(15)8-12/h4,9-10,14H,2-3,5-8H2,1H3,(H,13,15)/t9-,10+/m0/s1.
What are the key properties of 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide?
2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide has a molecular weight of 217.28 g/mol, XLogP of 1.57, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(3S,4R)-4-hydroxynon-1-en-3-yl]acetamide is sourced from PubChem (CID 166444522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).