C21H40O3 — CID 166444571
(6E,8E,10R)-1,1-diethoxy-10-methylhexadeca-6,8-dien-5-ol (PubChem CID 166444571) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is (6E,8E,10R)-1,1-diethoxy-10-methylhexadeca-6,8-dien-5-ol.
| Compound Name | (6E,8E,10R)-1,1-diethoxy-10-methylhexadeca-6,8-dien-5-ol |
|---|---|
| PubChem CID | 166444571 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | (6E,8E,10R)-1,1-diethoxy-10-methylhexadeca-6,8-dien-5-ol |
| SMILES | CCCCCC[C@@H](C)/C=C/C=C/C(O)CCCC(OCC)OCC |
| InChI | InChI=1S/C21H40O3/c1-5-8-9-10-14-19(4)15-11-12-16-20(22)17-13-18-21(23-6-2)24-7-3/h11-12,15-16,19-22H,5-10,13-14,17-18H2,1-4H3/b15-11+,16-12+/t19-,20?/m1/s1 |
| InChIKey | SFGJXMNZUIQUDR-BZNPAVMHSA-N |
| XLogP | 5.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|