C22H40O3 — CID 166444577
[(1R,2S,4aR,5S,8aS)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol (PubChem CID 166444577) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is [(1R,2S,4aR,5S,8aS)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol.
| Compound Name | [(1R,2S,4aR,5S,8aS)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 166444577 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | [(1R,2S,4aR,5S,8aS)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol |
| SMILES | CCCCCC[C@@H](C)[C@H]1C=C[C@H]2[C@@H](OCOC)CCC[C@@H]2[C@@]1(C)CO |
| InChI | InChI=1S/C22H40O3/c1-5-6-7-8-10-17(2)19-14-13-18-20(22(19,3)15-23)11-9-12-21(18)25-16-24-4/h13-14,17-21,23H,5-12,15-16H2,1-4H3/t17-,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | DGSBCXSNBGLHGF-UQOPEDAQSA-N |
| XLogP | 5.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|