C26H46O5 — CID 166444581
1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one (PubChem CID 166444581) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one.
| Compound Name | 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one |
|---|---|
| PubChem CID | 166444581 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 1-[(1S,2R,4aS,5R,8aR)-5-(methoxymethoxy)-1-methyl-2-[(2R)-octan-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one |
| SMILES | CCCCCC[C@@H](C)[C@@H]1C=C[C@H]2[C@@H](CCC[C@H]2OCOC)[C@]1(C)C(=O)CC(OC)OC |
| InChI | InChI=1S/C26H46O5/c1-7-8-9-10-12-19(2)21-16-15-20-22(13-11-14-23(20)31-18-28-4)26(21,3)24(27)17-25(29-5)30-6/h15-16,19-23,25H,7-14,17-18H2,1-6H3/t19-,20+,21+,22-,23-,26-/m1/s1 |
| InChIKey | AHNFTYRXIJRDGV-MZNUZNHHSA-N |
| XLogP | 5.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|