About (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one
(3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one (PubChem CID 166444606) has the molecular formula C14H18ClNO
and a molecular weight of 251.76 g/mol. Its IUPAC name is (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one |
| PubChem CID | 166444606 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)[C@@](C)(CCCCCl)c2ccccc21 |
| InChI | InChI=1S/C14H18ClNO/c1-14(9-5-6-10-15)11-7-3-4-8-12(11)16(2)13(14)17/h3-4,7-8H,5-6,9-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | CFIQBVKMIIWFCS-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one?
The IUPAC name of (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one (CID 166444606) is (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one.
What is the SMILES notation for (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one?
The canonical SMILES for (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one is CN1C(=O)[C@@](C)(CCCCCl)c2ccccc21.
What is the InChIKey of (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one?
The InChIKey is CFIQBVKMIIWFCS-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H18ClNO/c1-14(9-5-6-10-15)11-7-3-4-8-12(11)16(2)13(14)17/h3-4,7-8H,5-6,9-10H2,1-2H3/t14-/m0/s1.
What are the key properties of (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one?
(3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one has a molecular weight of 251.76 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-chlorobutyl)-1,3-dimethylindol-2-one is sourced from PubChem (CID 166444606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).