C16H24O3 — CID 166444758
(4'aS,8'aS)-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 166444758) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (4'aS,8'aS)-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aS,8'aS)-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 166444758 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (4'aS,8'aS)-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CC1=CC[C@H]2C(C)(C)C3(CC[C@]2(C)C1=O)OCCO3 |
| InChI | InChI=1S/C16H24O3/c1-11-5-6-12-14(2,3)16(18-9-10-19-16)8-7-15(12,4)13(11)17/h5,12H,6-10H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | FEKMAOGIVXBXCL-WFASDCNBSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |