C25H40O4 — CID 166444759
(1'S,4'aR,8'aS)-1'-[[(1R,4R,6S)-4-hydroxy-1,6-dimethylcyclohex-2-en-1-yl]methyl]-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-ol (PubChem CID 166444759) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (1'S,4'aR,8'aS)-1'-[[(1R,4R,6S)-4-hydroxy-1,6-dimethylcyclohex-2-en-1-yl]methyl]-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-ol.
| Compound Name | (1'S,4'aR,8'aS)-1'-[[(1R,4R,6S)-4-hydroxy-1,6-dimethylcyclohex-2-en-1-yl]methyl]-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-ol |
|---|---|
| PubChem CID | 166444759 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (1'S,4'aR,8'aS)-1'-[[(1R,4R,6S)-4-hydroxy-1,6-dimethylcyclohex-2-en-1-yl]methyl]-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydronaphthalene]-1'-ol |
| SMILES | CC1=CC[C@H]2C(C)(C)C3(CC[C@]2(C)[C@]1(O)C[C@@]1(C)C=C[C@H](O)C[C@@H]1C)OCCO3 |
| InChI | InChI=1S/C25H40O4/c1-17-7-8-20-21(3,4)25(28-13-14-29-25)12-11-23(20,6)24(17,27)16-22(5)10-9-19(26)15-18(22)2/h7,9-10,18-20,26-27H,8,11-16H2,1-6H3/t18-,19-,20-,22+,23-,24-/m0/s1 |
| InChIKey | TXTBVEAOALMUGZ-CRKAGTSRSA-N |
| XLogP | 4.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|