C25H31O2+ — CID 166444820
[1,1,4a-trimethyl-6-oxo-9-[(E)-2-phenylethenyl]-2,3,4,8a,10,10a-hexahydrophenanthren-9-yl]oxidanium (PubChem CID 166444820) has the molecular formula C25H31O2+ and a molecular weight of 363.52 g/mol. Its IUPAC name is [1,1,4a-trimethyl-6-oxo-9-[(E)-2-phenylethenyl]-2,3,4,8a,10,10a-hexahydrophenanthren-9-yl]oxidanium.
| Compound Name | [1,1,4a-trimethyl-6-oxo-9-[(E)-2-phenylethenyl]-2,3,4,8a,10,10a-hexahydrophenanthren-9-yl]oxidanium |
|---|---|
| PubChem CID | 166444820 |
| Molecular Formula | C25H31O2+ |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [1,1,4a-trimethyl-6-oxo-9-[(E)-2-phenylethenyl]-2,3,4,8a,10,10a-hexahydrophenanthren-9-yl]oxidanium |
| SMILES | CC1(C)CCCC2(C)C3=CC(=O)C=CC3C([OH2+])(/C=C/c3ccccc3)CC12 |
| InChI | InChI=1S/C25H30O2/c1-23(2)13-7-14-24(3)21-16-19(26)10-11-20(21)25(27,17-22(23)24)15-12-18-8-5-4-6-9-18/h4-6,8-12,15-16,20,22,27H,7,13-14,17H2,1-3H3/p+1/b15-12+ |
| InChIKey | CKAMZOSLJRQDJK-NTCAYCPXSA-O |
| XLogP | 5.08 |
| TPSA | 39.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|