About 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole
5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole (PubChem CID 166444836) has the molecular formula C16H10N2S2
and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole |
| PubChem CID | 166444836 |
| Molecular Formula | C16H10N2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole |
| SMILES | c1ccc2cc(Sc3ccc4nsnc4c3)ccc2c1 |
| InChI | InChI=1S/C16H10N2S2/c1-2-4-12-9-13(6-5-11(12)3-1)19-14-7-8-15-16(10-14)18-20-17-15/h1-10H |
| InChIKey | KWHVDJQMFNBGFV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole?
The IUPAC name of 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole (CID 166444836) is 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole?
The canonical SMILES for 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole is c1ccc2cc(Sc3ccc4nsnc4c3)ccc2c1.
What is the InChIKey of 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole?
The InChIKey is KWHVDJQMFNBGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2S2/c1-2-4-12-9-13(6-5-11(12)3-1)19-14-7-8-15-16(10-14)18-20-17-15/h1-10H.
What are the key properties of 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole?
5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole has a molecular weight of 294.40 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-naphthalen-2-ylsulfanyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 166444836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).