About 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole
5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole (PubChem CID 166445008) has the molecular formula C14H12N2S2
and a molecular weight of 272.40 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole |
| PubChem CID | 166445008 |
| Molecular Formula | C14H12N2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole |
| SMILES | Cc1cccc(C)c1Sc1ccc2nsnc2c1 |
| InChI | InChI=1S/C14H12N2S2/c1-9-4-3-5-10(2)14(9)17-11-6-7-12-13(8-11)16-18-15-12/h3-8H,1-2H3 |
| InChIKey | RUYGZWNKJCTXFC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole?
The IUPAC name of 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole (CID 166445008) is 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole?
The canonical SMILES for 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole is Cc1cccc(C)c1Sc1ccc2nsnc2c1.
What is the InChIKey of 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole?
The InChIKey is RUYGZWNKJCTXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2S2/c1-9-4-3-5-10(2)14(9)17-11-6-7-12-13(8-11)16-18-15-12/h3-8H,1-2H3.
What are the key properties of 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole?
5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole has a molecular weight of 272.40 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dimethylphenyl)sulfanyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 166445008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).