C17H31IO3Si — CID 166445119
tert-butyl-[(1S,4S)-4-ethenyl-3-iodo-4-(methoxymethoxy)-5,5-dimethylcyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 166445119) has the molecular formula C17H31IO3Si and a molecular weight of 438.42 g/mol. Its IUPAC name is tert-butyl-[(1S,4S)-4-ethenyl-3-iodo-4-(methoxymethoxy)-5,5-dimethylcyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,4S)-4-ethenyl-3-iodo-4-(methoxymethoxy)-5,5-dimethylcyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 166445119 |
| Molecular Formula | C17H31IO3Si |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | tert-butyl-[(1S,4S)-4-ethenyl-3-iodo-4-(methoxymethoxy)-5,5-dimethylcyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@]1(OCOC)C(I)=C[C@H](O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H31IO3Si/c1-10-17(20-12-19-7)13(18)11-14(16(17,5)6)21-22(8,9)15(2,3)4/h10-11,14H,1,12H2,2-9H3/t14-,17+/m0/s1 |
| InChIKey | JSMBQOKYUHQAPG-WMLDXEAASA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|