C24H43IO2Si — CID 166445274
[(3R,4aS,6aR,10aR,10bS)-2-iodo-4a,7,7,10a-tetramethyl-3,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 166445274) has the molecular formula C24H43IO2Si and a molecular weight of 518.60 g/mol. Its IUPAC name is [(3R,4aS,6aR,10aR,10bS)-2-iodo-4a,7,7,10a-tetramethyl-3,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4aS,6aR,10aR,10bS)-2-iodo-4a,7,7,10a-tetramethyl-3,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 166445274 |
| Molecular Formula | C24H43IO2Si |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [(3R,4aS,6aR,10aR,10bS)-2-iodo-4a,7,7,10a-tetramethyl-3,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CC[C@]1(C)O[C@H](CO[Si](C)(C)C(C)(C)C)C(I)=C[C@@H]21 |
| InChI | InChI=1S/C24H43IO2Si/c1-21(2,3)28(8,9)26-16-18-17(25)15-20-23(6)13-10-12-22(4,5)19(23)11-14-24(20,7)27-18/h15,18-20H,10-14,16H2,1-9H3/t18-,19-,20+,23-,24+/m1/s1 |
| InChIKey | UPXHMDMTVIFALW-PCIFRVRHSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|