About 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole
3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole (PubChem CID 166445478) has the molecular formula C25H20BrFN2
and a molecular weight of 447.35 g/mol. Its IUPAC name is 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole.
Molecular Properties
| Compound Name | 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole |
| PubChem CID | 166445478 |
| Molecular Formula | C25H20BrFN2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole |
| SMILES | Cc1c(C(c2ccc(F)cc2)c2c[nH]c3ccc(Br)cc23)c2ccccc2n1C |
| InChI | InChI=1S/C25H20BrFN2/c1-15-24(19-5-3-4-6-23(19)29(15)2)25(16-7-10-18(27)11-8-16)21-14-28-22-12-9-17(26)13-20(21)22/h3-14,25,28H,1-2H3 |
| InChIKey | WKWWMEBTBLSYCG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole?
The IUPAC name of 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole (CID 166445478) is 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole.
What is the SMILES notation for 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole?
The canonical SMILES for 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole is Cc1c(C(c2ccc(F)cc2)c2c[nH]c3ccc(Br)cc23)c2ccccc2n1C.
What is the InChIKey of 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole?
The InChIKey is WKWWMEBTBLSYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20BrFN2/c1-15-24(19-5-3-4-6-23(19)29(15)2)25(16-7-10-18(27)11-8-16)21-14-28-22-12-9-17(26)13-20(21)22/h3-14,25,28H,1-2H3.
What are the key properties of 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole?
3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole has a molecular weight of 447.35 g/mol, XLogP of 7.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-1H-indol-3-yl)-(4-fluorophenyl)methyl]-1,2-dimethylindole is sourced from PubChem (CID 166445478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).