C32H40O6Si — CID 166445547
prop-2-enyl (E,4R)-4-acetyloxy-5-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-methyl-5-oxocyclopentyl]pent-2-enoate (PubChem CID 166445547) has the molecular formula C32H40O6Si and a molecular weight of 548.75 g/mol. Its IUPAC name is prop-2-enyl (E,4R)-4-acetyloxy-5-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-methyl-5-oxocyclopentyl]pent-2-enoate.
| Compound Name | prop-2-enyl (E,4R)-4-acetyloxy-5-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-methyl-5-oxocyclopentyl]pent-2-enoate |
|---|---|
| PubChem CID | 166445547 |
| Molecular Formula | C32H40O6Si |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | prop-2-enyl (E,4R)-4-acetyloxy-5-[(1R,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-methyl-5-oxocyclopentyl]pent-2-enoate |
| SMILES | C=CCOC(=O)/C=C/[C@@H](C[C@@]1(C)C(=O)CC[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C32H40O6Si/c1-7-22-36-30(35)21-18-25(37-24(2)33)23-32(6)28(34)19-20-29(32)38-39(31(3,4)5,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h7-18,21,25,29H,1,19-20,22-23H2,2-6H3/b21-18+/t25-,29-,32-/m0/s1 |
| InChIKey | CIYMPCFLEXPZGW-GRMGFZFASA-N |
| XLogP | 4.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|