C19H25NO3 — CID 166445645
(2S,6S,11S,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadecane-5,10,15-trione (PubChem CID 166445645) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2S,6S,11S,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadecane-5,10,15-trione.
| Compound Name | (2S,6S,11S,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadecane-5,10,15-trione |
|---|---|
| PubChem CID | 166445645 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2S,6S,11S,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadecane-5,10,15-trione |
| SMILES | C=CC[C@@]12C(=O)CCC[C@@H]3C(=O)N4C[C@@H](C)C(CC4[C@@]31C)C2=O |
| InChI | InChI=1S/C19H25NO3/c1-4-8-19-15(21)7-5-6-13-17(23)20-10-11(2)12(16(19)22)9-14(20)18(13,19)3/h4,11-14H,1,5-10H2,2-3H3/t11-,12?,13-,14?,18-,19+/m1/s1 |
| InChIKey | PIKGJNCOFXGAHY-VGXMKXKYSA-N |
| XLogP | 2.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|