C47H36ClFN4O5 — CID 166445792
N-[(1S)-2-[2-[(Z)-(1-benzyl-6-fluoro-2-oxoindol-3-ylidene)-(5-methoxy-1H-indol-2-yl)methyl]-4-methoxyanilino]-1-(4-chlorophenyl)-2-oxoethyl]benzamide (PubChem CID 166445792) has the molecular formula C47H36ClFN4O5 and a molecular weight of 791.28 g/mol. Its IUPAC name is N-[(1S)-2-[2-[(Z)-(1-benzyl-6-fluoro-2-oxoindol-3-ylidene)-(5-methoxy-1H-indol-2-yl)methyl]-4-methoxyanilino]-1-(4-chlorophenyl)-2-oxoethyl]benzamide.
| Compound Name | N-[(1S)-2-[2-[(Z)-(1-benzyl-6-fluoro-2-oxoindol-3-ylidene)-(5-methoxy-1H-indol-2-yl)methyl]-4-methoxyanilino]-1-(4-chlorophenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 166445792 |
| Molecular Formula | C47H36ClFN4O5 |
| Molecular Weight | 791.28 g/mol |
| Exact Mass | 790.24 |
| IUPAC Name | N-[(1S)-2-[2-[(Z)-(1-benzyl-6-fluoro-2-oxoindol-3-ylidene)-(5-methoxy-1H-indol-2-yl)methyl]-4-methoxyanilino]-1-(4-chlorophenyl)-2-oxoethyl]benzamide |
| SMILES | COc1ccc(NC(=O)[C@@H](NC(=O)c2ccccc2)c2ccc(Cl)cc2)c(/C(=C2/C(=O)N(Cc3ccccc3)c3cc(F)ccc32)c2cc3cc(OC)ccc3[nH]2)c1 |
| InChI | InChI=1S/C47H36ClFN4O5/c1-57-34-18-21-38-31(23-34)24-40(50-38)42(43-36-20-17-33(49)25-41(36)53(47(43)56)27-28-9-5-3-6-10-28)37-26-35(58-2)19-22-39(37)51-46(55)44(29-13-15-32(48)16-14-29)52-45(54)30-11-7-4-8-12-30/h3-26,44,50H,27H2,1-2H3,(H,51,55)(H,52,54)/b43-42-/t44-/m0/s1 |
| InChIKey | UHZXQXZPNCJHQP-REVICLPESA-N |
| XLogP | 9.59 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.28 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|