About (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one
(3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one (PubChem CID 166445874) has the molecular formula C18H14ClNO2
and a molecular weight of 311.77 g/mol. Its IUPAC name is (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one.
Molecular Properties
| Compound Name | (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one |
| PubChem CID | 166445874 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one |
| SMILES | O=C1N[C@]2(OCC/C2=C\c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H14ClNO2/c19-14-7-5-12(6-8-14)11-13-9-10-22-18(13)16-4-2-1-3-15(16)17(21)20-18/h1-8,11H,9-10H2,(H,20,21)/b13-11+/t18-/m1/s1 |
| InChIKey | YIQSSNRHPSXSHE-IYPOZPNPSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one?
The IUPAC name of (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one (CID 166445874) is (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one.
What is the SMILES notation for (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one?
The canonical SMILES for (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one is O=C1N[C@]2(OCC/C2=C\c2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one?
The InChIKey is YIQSSNRHPSXSHE-IYPOZPNPSA-N. The full InChI is InChI=1S/C18H14ClNO2/c19-14-7-5-12(6-8-14)11-13-9-10-22-18(13)16-4-2-1-3-15(16)17(21)20-18/h1-8,11H,9-10H2,(H,20,21)/b13-11+/t18-/m1/s1.
What are the key properties of (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one?
(3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one has a molecular weight of 311.77 g/mol, XLogP of 3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,3'E)-3'-[(4-chlorophenyl)methylidene]spiro[2H-isoindole-3,2'-oxolane]-1-one is sourced from PubChem (CID 166445874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).