C20H19NO2 — CID 166445878
(3R,3'E)-3'-benzylidene-5'-ethylspiro[2H-isoindole-3,2'-oxolane]-1-one (PubChem CID 166445878) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3R,3'E)-3'-benzylidene-5'-ethylspiro[2H-isoindole-3,2'-oxolane]-1-one.
| Compound Name | (3R,3'E)-3'-benzylidene-5'-ethylspiro[2H-isoindole-3,2'-oxolane]-1-one |
|---|---|
| PubChem CID | 166445878 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3R,3'E)-3'-benzylidene-5'-ethylspiro[2H-isoindole-3,2'-oxolane]-1-one |
| SMILES | CCC1C/C(=C\c2ccccc2)[C@@]2(NC(=O)c3ccccc32)O1 |
| InChI | InChI=1S/C20H19NO2/c1-2-16-13-15(12-14-8-4-3-5-9-14)20(23-16)18-11-7-6-10-17(18)19(22)21-20/h3-12,16H,2,13H2,1H3,(H,21,22)/b15-12+/t16?,20-/m1/s1 |
| InChIKey | OGDDNAATPUHXBE-SSCHOHFYSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |