C24H14O4S3 — CID 166445903
2-[4-[4-(3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylphenyl]sulfanylphenyl]sulfanylcyclohexa-2,5-diene-1,4-dione (PubChem CID 166445903) has the molecular formula C24H14O4S3 and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[4-[4-(3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylphenyl]sulfanylphenyl]sulfanylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-[4-(3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylphenyl]sulfanylphenyl]sulfanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 166445903 |
| Molecular Formula | C24H14O4S3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 2-[4-[4-(3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylphenyl]sulfanylphenyl]sulfanylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(Sc2ccc(Sc3ccc(SC4=CC(=O)C=CC4=O)cc3)cc2)=C1 |
| InChI | InChI=1S/C24H14O4S3/c25-15-1-11-21(27)23(13-15)30-19-7-3-17(4-8-19)29-18-5-9-20(10-6-18)31-24-14-16(26)2-12-22(24)28/h1-14H |
| InChIKey | OGCCHXMPDIZTLM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|