About 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile
4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile (PubChem CID 166445952) has the molecular formula C22H18N2
and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile |
| PubChem CID | 166445952 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2c3ccccc3CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2/c23-16-17-10-13-20(14-11-17)24-21-9-5-4-8-19(21)12-15-22(24)18-6-2-1-3-7-18/h1-11,13-14,22H,12,15H2/t22-/m1/s1 |
| InChIKey | NFALAALYEGDANG-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile?
The IUPAC name of 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile (CID 166445952) is 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile.
What is the SMILES notation for 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile?
The canonical SMILES for 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile is N#Cc1ccc(N2c3ccccc3CC[C@@H]2c2ccccc2)cc1.
What is the InChIKey of 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile?
The InChIKey is NFALAALYEGDANG-JOCHJYFZSA-N. The full InChI is InChI=1S/C22H18N2/c23-16-17-10-13-20(14-11-17)24-21-9-5-4-8-19(21)12-15-22(24)18-6-2-1-3-7-18/h1-11,13-14,22H,12,15H2/t22-/m1/s1.
What are the key properties of 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile?
4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile has a molecular weight of 310.40 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-phenyl-3,4-dihydro-2H-quinolin-1-yl]benzonitrile is sourced from PubChem (CID 166445952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).