C30H24FNO — CID 166445954
(2R,11S,12R,19S)-5-fluoro-12,19-diphenyl-9-oxa-1-azapentacyclo[11.6.1.02,11.03,8.017,20]icosa-3(8),4,6,13,15,17(20)-hexaene (PubChem CID 166445954) has the molecular formula C30H24FNO and a molecular weight of 433.53 g/mol. Its IUPAC name is (2R,11S,12R,19S)-5-fluoro-12,19-diphenyl-9-oxa-1-azapentacyclo[11.6.1.02,11.03,8.017,20]icosa-3(8),4,6,13,15,17(20)-hexaene.
| Compound Name | (2R,11S,12R,19S)-5-fluoro-12,19-diphenyl-9-oxa-1-azapentacyclo[11.6.1.02,11.03,8.017,20]icosa-3(8),4,6,13,15,17(20)-hexaene |
|---|---|
| PubChem CID | 166445954 |
| Molecular Formula | C30H24FNO |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2R,11S,12R,19S)-5-fluoro-12,19-diphenyl-9-oxa-1-azapentacyclo[11.6.1.02,11.03,8.017,20]icosa-3(8),4,6,13,15,17(20)-hexaene |
| SMILES | Fc1ccc2c(c1)[C@H]1[C@@H](CO2)[C@H](c2ccccc2)c2cccc3c2N1[C@H](c1ccccc1)C3 |
| InChI | InChI=1S/C30H24FNO/c31-22-14-15-27-24(17-22)30-25(18-33-27)28(20-10-5-2-6-11-20)23-13-7-12-21-16-26(32(30)29(21)23)19-8-3-1-4-9-19/h1-15,17,25-26,28,30H,16,18H2/t25-,26-,28+,30-/m0/s1 |
| InChIKey | QMJIUSZGQXUANU-UAUQNLOISA-N |
| XLogP | 6.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |