About (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene
(3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene (PubChem CID 166446014) has the molecular formula C18H20O3S
and a molecular weight of 316.42 g/mol. Its IUPAC name is (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene.
Molecular Properties
| Compound Name | (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene |
| PubChem CID | 166446014 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene |
| SMILES | CC1(C)O[C@H](CS(=O)(=O)c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C18H20O3S/c1-18(2)17-11-7-6-8-14(17)12-15(21-18)13-22(19,20)16-9-4-3-5-10-16/h3-11,15H,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | BENSWMWXYWQCQA-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene?
The IUPAC name of (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene (CID 166446014) is (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene.
What is the SMILES notation for (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene?
The canonical SMILES for (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene is CC1(C)O[C@H](CS(=O)(=O)c2ccccc2)Cc2ccccc21.
What is the InChIKey of (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene?
The InChIKey is BENSWMWXYWQCQA-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H20O3S/c1-18(2)17-11-7-6-8-14(17)12-15(21-18)13-22(19,20)16-9-4-3-5-10-16/h3-11,15H,12-13H2,1-2H3/t15-/m0/s1.
What are the key properties of (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene?
(3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene has a molecular weight of 316.42 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(benzenesulfonylmethyl)-1,1-dimethyl-3,4-dihydroisochromene is sourced from PubChem (CID 166446014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).