About (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one
(2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one (PubChem CID 166446309) has the molecular formula C17H14BrNO2
and a molecular weight of 344.21 g/mol. Its IUPAC name is (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one |
| PubChem CID | 166446309 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one |
| SMILES | CC(=O)N1c2ccccc2C(=O)C[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C17H14BrNO2/c1-11(20)19-15-9-5-3-7-13(15)17(21)10-16(19)12-6-2-4-8-14(12)18/h2-9,16H,10H2,1H3/t16-/m0/s1 |
| InChIKey | VDHLCKRYGMZLEA-INIZCTEOSA-N |
| XLogP | 4.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one?
The IUPAC name of (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one (CID 166446309) is (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one.
What is the SMILES notation for (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one?
The canonical SMILES for (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one is CC(=O)N1c2ccccc2C(=O)C[C@H]1c1ccccc1Br.
What is the InChIKey of (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one?
The InChIKey is VDHLCKRYGMZLEA-INIZCTEOSA-N. The full InChI is InChI=1S/C17H14BrNO2/c1-11(20)19-15-9-5-3-7-13(15)17(21)10-16(19)12-6-2-4-8-14(12)18/h2-9,16H,10H2,1H3/t16-/m0/s1.
What are the key properties of (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one?
(2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one has a molecular weight of 344.21 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-acetyl-2-(2-bromophenyl)-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 166446309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).