C16H26F3NO3SSi — CID 166446320
N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylphenyl)ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 166446320) has the molecular formula C16H26F3NO3SSi and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylphenyl)ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylphenyl)ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 166446320 |
| Molecular Formula | C16H26F3NO3SSi |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylphenyl)ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1ccccc1[C@H](CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H26F3NO3SSi/c1-12-9-7-8-10-13(12)14(20-24(21,22)16(17,18)19)11-23-25(5,6)15(2,3)4/h7-10,14,20H,11H2,1-6H3/t14-/m0/s1 |
| InChIKey | ZSMMIYGSLSZZEE-AWEZNQCLSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|