About (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride
(1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride (PubChem CID 166446378) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride.
Molecular Properties
| Compound Name | (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride |
| PubChem CID | 166446378 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride |
| SMILES | CCOC(=O)C([NH3+])CC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H15NO3.ClH/c1-2-16-12(15)10(13)8-11(14)9-6-4-3-5-7-9;/h3-7,10H,2,8,13H2,1H3;1H |
| InChIKey | YEAJYWZPNNCZAV-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride?
The IUPAC name of (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride (CID 166446378) is (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride.
What is the SMILES notation for (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride?
The canonical SMILES for (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride is CCOC(=O)C([NH3+])CC(=O)c1ccccc1.[Cl-].
What is the InChIKey of (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride?
The InChIKey is YEAJYWZPNNCZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.ClH/c1-2-16-12(15)10(13)8-11(14)9-6-4-3-5-7-9;/h3-7,10H,2,8,13H2,1H3;1H.
What are the key properties of (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride?
(1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride has a molecular weight of 257.72 g/mol, XLogP of -2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl)azanium chloride is sourced from PubChem (CID 166446378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).