C22H22N2O5 — CID 166446646
tert-butyl N-(1-benzoyl-5-methoxyindole-2-carbonyl)carbamate (PubChem CID 166446646) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is tert-butyl N-(1-benzoyl-5-methoxyindole-2-carbonyl)carbamate.
| Compound Name | tert-butyl N-(1-benzoyl-5-methoxyindole-2-carbonyl)carbamate |
|---|---|
| PubChem CID | 166446646 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl N-(1-benzoyl-5-methoxyindole-2-carbonyl)carbamate |
| SMILES | COc1ccc2c(c1)cc(C(=O)NC(=O)OC(C)(C)C)n2C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-22(2,3)29-21(27)23-19(25)18-13-15-12-16(28-4)10-11-17(15)24(18)20(26)14-8-6-5-7-9-14/h5-13H,1-4H3,(H,23,25,27) |
| InChIKey | ZKACFMVDEMZNBG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |