C31H28N2O2 — CID 166446736
(4S)-2-[(E)-[(3E)-5,6-dimethyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]inden-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 166446736) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (4S)-2-[(E)-[(3E)-5,6-dimethyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]inden-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[(E)-[(3E)-5,6-dimethyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]inden-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 166446736 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (4S)-2-[(E)-[(3E)-5,6-dimethyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]inden-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc2c(cc1C)/C(=C/C1=N[C@@H](c3ccccc3)CO1)C/C2=C\C1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C31H28N2O2/c1-20-13-26-24(16-30-32-28(18-34-30)22-9-5-3-6-10-22)15-25(27(26)14-21(20)2)17-31-33-29(19-35-31)23-11-7-4-8-12-23/h3-14,16-17,28-29H,15,18-19H2,1-2H3/b24-16+,25-17+/t28-,29-/m1/s1 |
| InChIKey | YDRXJAJXFYZHHO-BMCDVJGYSA-N |
| XLogP | 6.81 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |