C24H28O9 — CID 166447139
methyl (2R,3S,4R,8aS)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-phenyl-3,4,4a,7,8,8a-hexahydro-2H-chromene-8-carboxylate (PubChem CID 166447139) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is methyl (2R,3S,4R,8aS)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-phenyl-3,4,4a,7,8,8a-hexahydro-2H-chromene-8-carboxylate.
| Compound Name | methyl (2R,3S,4R,8aS)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-phenyl-3,4,4a,7,8,8a-hexahydro-2H-chromene-8-carboxylate |
|---|---|
| PubChem CID | 166447139 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | methyl (2R,3S,4R,8aS)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-phenyl-3,4,4a,7,8,8a-hexahydro-2H-chromene-8-carboxylate |
| SMILES | COC(=O)C1CC=C(c2ccccc2)C2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C24H28O9/c1-13(25)30-12-19-22(31-14(2)26)23(32-15(3)27)20-17(16-8-6-5-7-9-16)10-11-18(21(20)33-19)24(28)29-4/h5-10,18-23H,11-12H2,1-4H3/t18?,19-,20?,21-,22-,23-/m1/s1 |
| InChIKey | GGERZKGEFCULOL-WFSGVSCASA-N |
| XLogP | 2.07 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|