C22H30BBrN2O2 — CID 166447170
3-(4-bromophenyl)-N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-amine (PubChem CID 166447170) has the molecular formula C22H30BBrN2O2 and a molecular weight of 445.21 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 166447170 |
| Molecular Formula | C22H30BBrN2O2 |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-(4-bromophenyl)-N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-amine |
| SMILES | CN(C)CCC(c1ccc(Br)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C22H30BBrN2O2/c1-21(2)22(3,4)28-23(27-21)17-9-12-20(25-15-17)19(13-14-26(5)6)16-7-10-18(24)11-8-16/h7-12,15,19H,13-14H2,1-6H3 |
| InChIKey | HKBPPOCLTOXHPH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|