C19H23N2O3+ — CID 166447181
(3Z)-3-[1-(3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium-1-yl)ethylidene]-4-hydroxy-4H-chromen-2-one (PubChem CID 166447181) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is (3Z)-3-[1-(3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium-1-yl)ethylidene]-4-hydroxy-4H-chromen-2-one.
| Compound Name | (3Z)-3-[1-(3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium-1-yl)ethylidene]-4-hydroxy-4H-chromen-2-one |
|---|---|
| PubChem CID | 166447181 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (3Z)-3-[1-(3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium-1-yl)ethylidene]-4-hydroxy-4H-chromen-2-one |
| SMILES | C/C(=C1/C(=O)Oc2ccccc2C1O)N1CC[N+]2=C1CCCCC2 |
| InChI | InChI=1S/C19H23N2O3/c1-13(21-12-11-20-10-6-2-3-9-16(20)21)17-18(22)14-7-4-5-8-15(14)24-19(17)23/h4-5,7-8,18,22H,2-3,6,9-12H2,1H3/q+1/b17-13- |
| InChIKey | AXBPHJKPXDNJTB-LGMDPLHJSA-N |
| XLogP | 2.21 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|