C12H13NRh — CID 166447454
2,3,4,9a-tetrahydro-1H-carbazole;rhodium (PubChem CID 166447454) has the molecular formula C12H13NRh and a molecular weight of 274.15 g/mol. Its IUPAC name is 2,3,4,9a-tetrahydro-1H-carbazole;rhodium.
| Compound Name | 2,3,4,9a-tetrahydro-1H-carbazole;rhodium |
|---|---|
| PubChem CID | 166447454 |
| Molecular Formula | C12H13NRh |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 2,3,4,9a-tetrahydro-1H-carbazole;rhodium |
| SMILES | [Rh].c1ccc2c(c1)=NC1CCCCC=21 |
| InChI | InChI=1S/C12H13N.Rh/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1,3,5,7,12H,2,4,6,8H2; |
| InChIKey | MCGVUJJSJUFANQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |