C18H13F3N2O — CID 166447670
3-methoxy-7-methyl-6-(trifluoromethyl)indolo[1,2-a]quinoxaline (PubChem CID 166447670) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 3-methoxy-7-methyl-6-(trifluoromethyl)indolo[1,2-a]quinoxaline.
| Compound Name | 3-methoxy-7-methyl-6-(trifluoromethyl)indolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 166447670 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-methoxy-7-methyl-6-(trifluoromethyl)indolo[1,2-a]quinoxaline |
| SMILES | COc1ccc2c(c1)nc(C(F)(F)F)c1c(C)c3ccccc3n12 |
| InChI | InChI=1S/C18H13F3N2O/c1-10-12-5-3-4-6-14(12)23-15-8-7-11(24-2)9-13(15)22-17(16(10)23)18(19,20)21/h3-9H,1-2H3 |
| InChIKey | DTUOIIOVWORCHW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |