About methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate
methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate (PubChem CID 166447887) has the molecular formula C23H19NO3S
and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate |
| PubChem CID | 166447887 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C23H19NO3S/c1-27-23(26)21-19(16-9-4-2-5-10-16)20(17-11-6-3-7-12-17)22(25)24(21)15-18-13-8-14-28-18/h2-14,21H,15H2,1H3 |
| InChIKey | INEJLLNHXWFJPL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate?
The IUPAC name of methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate (CID 166447887) is methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate is COC(=O)C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1Cc1cccs1.
What is the InChIKey of methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate?
The InChIKey is INEJLLNHXWFJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3S/c1-27-23(26)21-19(16-9-4-2-5-10-16)20(17-11-6-3-7-12-17)22(25)24(21)15-18-13-8-14-28-18/h2-14,21H,15H2,1H3.
What are the key properties of methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate?
methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate has a molecular weight of 389.48 g/mol, XLogP of 4.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-3,4-diphenyl-1-(thiophen-2-ylmethyl)-2H-pyrrole-2-carboxylate is sourced from PubChem (CID 166447887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).