About (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one
(5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one (PubChem CID 166447926) has the molecular formula C21H18F3NOS
and a molecular weight of 389.44 g/mol. Its IUPAC name is (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one.
Molecular Properties
| Compound Name | (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one |
| PubChem CID | 166447926 |
| Molecular Formula | C21H18F3NOS |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one |
| SMILES | CCc1c2n(c3ccccc13)C(=O)[C@@](C)(CSC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C21H18F3NOS/c1-3-13-14-8-5-7-11-17(14)25-18(13)15-9-4-6-10-16(15)20(2,19(25)26)12-27-21(22,23)24/h4-11H,3,12H2,1-2H3/t20-/m0/s1 |
| InChIKey | CNFYNNHOMWVPNL-FQEVSTJZSA-N |
| XLogP | 6.04 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one?
The IUPAC name of (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one (CID 166447926) is (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one.
What is the SMILES notation for (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one?
The canonical SMILES for (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one is CCc1c2n(c3ccccc13)C(=O)[C@@](C)(CSC(F)(F)F)c1ccccc1-2.
What is the InChIKey of (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one?
The InChIKey is CNFYNNHOMWVPNL-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H18F3NOS/c1-3-13-14-8-5-7-11-17(14)25-18(13)15-9-4-6-10-16(15)20(2,19(25)26)12-27-21(22,23)24/h4-11H,3,12H2,1-2H3/t20-/m0/s1.
What are the key properties of (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one?
(5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one has a molecular weight of 389.44 g/mol, XLogP of 6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-12-ethyl-5-methyl-5-(trifluoromethylsulfanylmethyl)indolo[2,1-a]isoquinolin-6-one is sourced from PubChem (CID 166447926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).